cas: 419571-68-9 — see every product listed under this CAS number, including other names
tert-butyl 4-(1-hydroxy-3-oxobut-1-en-1-yl)piperidine-1-carboxylate, 97% (CAS 419571-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624697-100MG |
| cas | 419571-68-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 500mg | 1185.02 Pln | |
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 5g | 4824.36 Pln | |
| Fluorochem | 10g | 7995.12 Pln | |
| Fluorochem | 25g | 19808.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(3-oxobutanoyl)piperidine-1-carboxylate (CAS 419571-68-9) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: tert-butyl 4-(3-oxobutanoyl)piperidine-1-carboxylate. InChIKey: AKTJBXNKJJLHFG-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | tert-butyl 4-(3-oxobutanoyl)piperidine-1-carboxylate |
| InChIKey | AKTJBXNKJJLHFG-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)