cas: 915396-44-0 — see every product listed under this CAS number, including other names
tert-butyl 5-methyl-3-oxo-2,3-dihydro-1H-pyrazole-1-carboxylate, 98% (CAS 915396-44-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637891-250MG |
| cas | 915396-44-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1606.74 Pln | |
| Fluorochem | 5g | 5167.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate (CAS 915396-44-0) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate. InChIKey: OKWSLQHJNUSTSW-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 3-methyl-5-oxo-1H-pyrazole-2-carboxylate |
| InChIKey | OKWSLQHJNUSTSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)