cas: 1060816-50-3 — see every product listed under this CAS number, including other names
tert-butyl 7-chloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate, 97%, 97% (CAS 1060816-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114068-100mg |
| cas | 1060816-50-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1413.20 Pln | |
| Chemat | 500mg | 2555.60 Pln | |
| Chemat | 1g | 4346.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-chloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate (CAS 1060816-50-3) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: tert-butyl 7-chloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate. InChIKey: KWEUYGQXJOTAGR-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | tert-butyl 7-chloro-3,4-dihydro-1H-2,6-naphthyridine-2-carboxylate |
| InChIKey | KWEUYGQXJOTAGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CN=C(C=C2C1)Cl |
Computed by PubChem (NCBI)