cas: 2306262-34-8 — see every product listed under this CAS number, including other names
tert-butyl 7-hydroxy-2,5-diazaspiro[3.4]octane-2-carboxylate, 97% (CAS 2306262-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch13197G-100mg |
| cas | 2306262-34-8 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 971.60 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 500mg | 2474.00 Pln | |
| Chemat | 1g | 3683.60 Pln | |
| Chemat | 5g | 10917.20 Pln | |
| Chemat | 10g | 18155.60 Pln | |
| Fluorochem | 100mg | 1794.18 Pln | |
| Fluorochem | 250mg | 2804.24 Pln | |
| Fluorochem | 500mg | 4584.86 Pln | |
| Fluorochem | 1g | 6703.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-hydroxy-2,5-diazaspiro[3.4]octane-2-carboxylate (CAS 2306262-34-8) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 7-hydroxy-2,5-diazaspiro[3.4]octane-2-carboxylate. InChIKey: VBEPRGVZKBMFPM-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 7-hydroxy-2,5-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | VBEPRGVZKBMFPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(CN2)O |
Computed by PubChem (NCBI)