cas: 405939-28-8 — see every product listed under this CAS number, including other names
tert-butyl N-(4-iodopyridin-2-yl)carbamate, ≥98%, ≥98% (CAS 405939-28-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYJ4-50mg |
| cas | 405939-28-8 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 318.80 Pln | |
| Chemat | 250mg | 1206.80 Pln | |
| Chemat | 1g | 3213.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-iodo-2-pyridinyl)carbamate (CAS 405939-28-8) is a chemical compound with the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. IUPAC name: tert-butyl N-(4-iodo-2-pyridinyl)carbamate. InChIKey: TTYADBPTZJSAMH-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O2 |
|---|---|
| Molecular weight | 320.13 g/mol |
| IUPAC name | tert-butyl N-(4-iodo-2-pyridinyl)carbamate |
| InChIKey | TTYADBPTZJSAMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)I |
Computed by PubChem (NCBI)