cas: 1393441-68-3 — see every product listed under this CAS number, including other names
tert-butyl N-{[3-(hydroxymethyl)oxetan-3-yl]methyl}carbamate, 97%, 97% (CAS 1393441-68-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WRF-100mg |
| cas | 1393441-68-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1950.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate (CAS 1393441-68-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate. InChIKey: VIDOCWLVTHFRNZ-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]carbamate |
| InChIKey | VIDOCWLVTHFRNZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(COC1)CO |
Computed by PubChem (NCBI)