cas: 1638771-06-8 — see every product listed under this CAS number, including other names
tert-butyl N-{3-formylbicyclo[1.1.1]pentan-1-yl}carbamate 97% (CAS 1638771-06-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A279851-100mg |
| cas | 1638771-06-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1026.75 Pln | |
| Ambeed | 1g | 2489.69 Pln | |
| Ambeed | 5g | 7662.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A279851 |
Tert-butyl N-(3-formyl-1-bicyclo[1.1.1]pentanyl)carbamate (CAS 1638771-06-8) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl N-(3-formyl-1-bicyclo[1.1.1]pentanyl)carbamate. InChIKey: XIUDXZJLBOFVKS-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl N-(3-formyl-1-bicyclo[1.1.1]pentanyl)carbamate |
| InChIKey | XIUDXZJLBOFVKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C=O |
Computed by PubChem (NCBI)