cas: 198835-02-8 — see every product listed under this CAS number, including other names
tert-butyl exo-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97% (CAS 198835-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519902-100MG |
| cas | 198835-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1377.66 Pln | |
| Fluorochem | 10g | 1908.72 Pln | |
| Fluorochem | 25g | 3746.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 198835-02-8) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: PABFVGKPNHVSCG-DJLDLDEBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | PABFVGKPNHVSCG-DJLDLDEBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1[C@@H](C2)O |
Computed by PubChem (NCBI)