cas: 2173637-24-4 — see every product listed under this CAS number, including other names
tert-butyl trans-3-aminocyclobutane-1-carboxylate hydrochloride 97% (CAS 2173637-24-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A554087-250mg |
| cas | 2173637-24-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 570.62 Pln | |
| Ambeed | 1g | 1438.38 Pln | |
| Ambeed | 5g | 4297.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A554087 |
Tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride (CAS 2173637-24-4) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride. InChIKey: ZYVBBJZQKIWNNB-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | tert-butyl 3-aminocyclobutane-1-carboxylate;hydrochloride |
| InChIKey | ZYVBBJZQKIWNNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)N.Cl |
Computed by PubChem (NCBI)