cas: 849935-83-7 — see every product listed under this CAS number, including other names
trans-1-tert-Butyl 3-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate, 98% (CAS 849935-83-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A347806-250mg |
| cas | 849935-83-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1772.12 Pln | |
| Ambeed | 5g | 6005.19 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 692.00 Pln | |
| BLDpharm | 1g | 1741.63 Pln | |
| BLDpharm | 5g | 5912.39 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1202.00 Pln | |
| Chemat | 5g | 4850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate (CAS 849935-83-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate. InChIKey: JHBUFXKTKCCCKA-RKDXNWHRSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate |
| InChIKey | JHBUFXKTKCCCKA-RKDXNWHRSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)