CAS 849935-85-9 appears in our catalog under these names: (3S,4R)-1-tert-Butyl 3-Ethyl 4-Hydroxypyrrolidine-1,3-dicarboxylate, (3S,4R)-1-tert-Butyl 3-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate, >95%, >95%, 1-(Tert-butyl) 3-ethyl (3S,4R)-4-hydroxypyrrolidine-1,3-dicarboxylate, 98%,RG. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
1-O-tert-butyl 3-O-ethyl (3S,4R)-4-hydroxypyrrolidine-1,3-dicarboxylate (CAS 849935-85-9) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-hydroxypyrrolidine-1,3-dicarboxylate. InChIKey: JHBUFXKTKCCCKA-IUCAKERBSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-hydroxypyrrolidine-1,3-dicarboxylate |
| InChIKey | JHBUFXKTKCCCKA-IUCAKERBSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)