Products 1523541-94-7

CAS 1523541-94-7 is the registry number for 1-(tert-Butyl) 3-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate (CAS 1523541-94-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate. InChIKey: JHBUFXKTKCCCKA-RKDXNWHRSA-N.

Identity
Molecular formulaC12H21NO5
Molecular weight259.30 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypyrrolidine-1,3-dicarboxylate
InChIKeyJHBUFXKTKCCCKA-RKDXNWHRSA-N
SMILESCCOC(=O)[C@@H]1CN(C[C@H]1O)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)