cas: 218772-92-0 — see every product listed under this CAS number, including other names
trans-3-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 95% (CAS 218772-92-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A526886-5g |
| cas | 218772-92-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5356.12 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 218772-92-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: JSGHMGKJNZTKGF-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | JSGHMGKJNZTKGF-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)