cas: 480425-30-7 — see every product listed under this CAS number, including other names
trans-4-(tert-Butyldimethylsiloxy)-1-buten-1-ylboronic acid pinacol ester 95% (CAS 480425-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1372686-100mg |
| cas | 480425-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1372686 |
Tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane (CAS 480425-30-7) is a chemical compound with the molecular formula C16H33BO3Si and a molecular weight of 312.3 g/mol. IUPAC name: tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane. InChIKey: ODTSJDLTXNDTBB-ZRDIBKRKSA-N.
| Molecular formula | C16H33BO3Si |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane |
| InChIKey | ODTSJDLTXNDTBB-ZRDIBKRKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)