cas: 99363-25-4 — see every product listed under this CAS number, including other names
trans-Cyclopentane-1,2-diamine dihydrochloride 98% (CAS 99363-25-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260837-100mg |
| cas | 99363-25-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4008.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260837 |
Trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride (CAS 99363-25-4) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-ALUAXPQUSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)