trans-Cyclopentane-1,2-diamine dihydrochloride, 98%, 98%
cas: 99363-25-4 — see every product listed under this CAS number, including other names
trans-Cyclopentane-1,2-diamine dihydrochloride, 98%, 98% (CAS 99363-25-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK0T-100mg |
| cas | 99363-25-4 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 986.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride (CAS 99363-25-4) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride. InChIKey: VZCLGIZICFQJBX-ALUAXPQUSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-diamine;dihydrochloride |
| InChIKey | VZCLGIZICFQJBX-ALUAXPQUSA-N |
| SMILES | C1C[C@H]([C@@H](C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1R,2R)-Cyclopentane-1,2-diamine--hydrogen chloride (1/2), trans-cyclopentane-1,2-diamine dihydrochloride, trans-Cyclopentane-1,2-diamine 2HCl, (1r,2r)-1,2-cyclopentanediamine dihydrochloride, (1R,2R)-cyclopentane-1,2-diamine;dihydrochloride, trans-Cyclopentane-1,2-diamine diHCl, 1,2-Cyclopentanediamine, dihydrochloride, (1R,2R)-rel-, trans-cyclopentane-1,2-diamine;dihydrochloride, (1R,2R)-trans-1,2-Cyclopentanediamine dihydrochloride, (1R,2R)-cyclopentane-1,2-diamine,dihydrochloride