cas: 222986-86-9 — see every product listed under this CAS number, including other names
trans-Methyl 4-(((tert-butoxycarbonyl)amino)methyl)cyclohexanecarboxylate, 97%, 97% (CAS 222986-86-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5E2-1g |
| cas | 222986-86-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 10g | 933.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylate (CAS 222986-86-9) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylate. InChIKey: JRJOPLNDRJAOCP-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | methyl 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylate |
| InChIKey | JRJOPLNDRJAOCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)OC |
Computed by PubChem (NCBI)