trans-Methyl 6-methylpiperidine-3-carboxylate hydrochloride, 95+%
cas: 1009376-86-6 — see every product listed under this CAS number, including other names
trans-Methyl 6-methylpiperidine-3-carboxylate hydrochloride, 95+% (CAS 1009376-86-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A379963-250mg |
| cas | 1009376-86-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1026.75 Pln | |
| Ambeed | 5g | 3424.19 Pln | |
| Ambeed | 10g | 5443.38 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1202.00 Pln | |
| Chemat | 5g | 4043.60 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1102.97 Pln | |
| BLDpharm | 5g | 3685.39 Pln | |
| BLDpharm | 10g | 5862.40 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (3R,6R)-6-methylpiperidine-3-carboxylate;hydrochloride (CAS 1009376-86-6) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,6R)-6-methylpiperidine-3-carboxylate;hydrochloride. InChIKey: COCIOCKRYRXGEP-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3R,6R)-6-methylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | COCIOCKRYRXGEP-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl trans-6-Methylpiperidine-3-carboxylate Hydrochloride, trans-Methyl 6-methylpiperidine-3-carboxylate hydrochloride, trans-Methyl 6-methylpiperidine-3-carboxylate HCl, (3r,6r)-methyl 6-methylpiperidine-3-carboxylate hydrochloride, methyl (3R,6R)-6-methylpiperidine-3-carboxylate;hydrochloride, Methyl (3R,6R)-6-Methylpiperidine-3-carboxylate HCl, (3r,6r)-methyl6-methylpiperidine-3-carboxylatehydrochloride, rel-Methyl (3R,6R)-6-methylpiperidine-3-carboxylate hydrochloride