cas: 138026-89-8 — see every product listed under this CAS number, including other names
trans-tert-Butyl 3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate 97% (CAS 138026-89-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A776007-250mg |
| cas | 138026-89-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 971.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A776007 |
Tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate (CAS 138026-89-8) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GVYATPKTSSTHKN-ZIAGYGMSSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GVYATPKTSSTHKN-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)