cas: 869193-57-7 — see every product listed under this CAS number, including other names
trans-tert-Butyl 4-hydroxycyclohexanecarboxylate 98% (CAS 869193-57-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A981182-50mg |
| cas | 869193-57-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 203.50 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3841.38 Pln | |
| Ambeed | 10g | 6105.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A981182 |
Tert-butyl 4-hydroxycyclohexane-1-carboxylate (CAS 869193-57-7) is a chemical compound with the molecular formula C11H20O3 and a molecular weight of 200.27 g/mol. IUPAC name: tert-butyl 4-hydroxycyclohexane-1-carboxylate. InChIKey: MVSANBPTBLEQMT-UHFFFAOYSA-N.
| Molecular formula | C11H20O3 |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | tert-butyl 4-hydroxycyclohexane-1-carboxylate |
| InChIKey | MVSANBPTBLEQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(CC1)O |
Computed by PubChem (NCBI)