cas: 51792-85-9 — see every product listed under this CAS number, including other names
(((2-Nitro-1,4-phenylene)bis(oxy))bis(methylene))dibenzene 97% (CAS 51792-85-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217300-250mg |
| cas | 51792-85-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 704.12 Pln | |
| Ambeed | 25g | 1332.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217300 |
2-nitro-1,4-bis(phenylmethoxy)benzene (CAS 51792-85-9) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 2-nitro-1,4-bis(phenylmethoxy)benzene. InChIKey: QDZFMSSFDIBXED-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-nitro-1,4-bis(phenylmethoxy)benzene |
| InChIKey | QDZFMSSFDIBXED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)OCC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)