Products 28387-13-5
CAS 28387-13-5 is the registry number for 1,2-Bis(benzyloxy)-4-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-nitro-1,2-bis(phenylmethoxy)benzene (CAS 28387-13-5) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 4-nitro-1,2-bis(phenylmethoxy)benzene. InChIKey: ZWEVOPCBFNUSMD-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-nitro-1,2-bis(phenylmethoxy)benzene |
| InChIKey | ZWEVOPCBFNUSMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[N+](=O)[O-])OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)