CAS 1022282-98-9 appears in our catalog under these names: 3-((2E)-3-[4-(Dimethylamino)phenyl]prop-2-enoyl)-4-hydroxy-2h-chromen-2-one, 95%, LM-021, 98.27%. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 1g, 50 mg, 10 mg, 25 mg, 5 mg, 100 mg.
3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one (CAS 1022282-98-9) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one. InChIKey: RGEZPZWWPVZCIT-FMIVXFBMSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-4-hydroxychromen-2-one |
| InChIKey | RGEZPZWWPVZCIT-FMIVXFBMSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C(=O)C2=C(C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)