CAS 198561-07-8 appears in our catalog under these names: Fmoc-L-propargylglycine, 97%, Fmoc-l-propargylglycine, >95% (HPLC), Fmoc–Pra–OH, Fmoc-L-Pra-OH, N-Fmoc-L-propargylglycine, 95% . Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 100g, 5g, 1g, 25g, 250mg, 50g, 500g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 198561-07-8) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)