cas: 21286-54-4 — see every product listed under this CAS number, including other names
((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride 90% (CAS 21286-54-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1003443-5g |
| cas | 21286-54-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 281.38 Pln |
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1003443 |
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride (CAS 21286-54-4) is a chemical compound with the molecular formula C10H15ClO3S and a molecular weight of 250.74 g/mol. IUPAC name: [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride. InChIKey: BGABKEVTHIJBIW-GMSGAONNSA-N.
| Molecular formula | C10H15ClO3S |
|---|---|
| Molecular weight | 250.74 g/mol |
| IUPAC name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonyl chloride |
| InChIKey | BGABKEVTHIJBIW-GMSGAONNSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)