cas: 56715-13-0 — see every product listed under this CAS number, including other names
(+)-Atenolol, 99%, 99% (CAS 56715-13-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CAM-5mg |
| cas | 56715-13-0 |
| size | 5mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 534.80 Pln | |
| Chemat | 100mg | 4096.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(R)-atenolol is the (R)-enantiomer of atenolol.
Source: ChEBI
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 2-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-GFCCVEGCSA-N |
| SMILES | CC(C)NC[C@H](COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)