cas: 56715-13-0 — see every product listed under this CAS number, including other names
(R)–(+)–Atenolol (CAS 56715-13-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 1mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC11952-10 |
| cas | 56715-13-0 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 835.75 Pln | |
| GLPBio | 5mg | 667.25 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 690.65 Pln | |
| GLPBio | 1mg | 657.89 Pln | |
| GLPBio | 10mg | 1369.32 Pln | |
| GLPBio | 5mg | 938.72 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(R)-atenolol is the (R)-enantiomer of atenolol.
Source: ChEBI
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 2-[4-[(2R)-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
| InChIKey | METKIMKYRPQLGS-GFCCVEGCSA-N |
| SMILES | CC(C)NC[C@H](COC1=CC=C(C=C1)CC(=O)N)O |
Computed by PubChem (NCBI)