(+)-Biotin-PEG3-amine, 95%, 95%
cas: 359860-27-8 — see every product listed under this CAS number, including other names
(+)-Biotin-PEG3-amine, 95%, 95% (CAS 359860-27-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CIL2-25mg |
| cas | 359860-27-8 |
| size | 25mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 256.40 Pln | |
| Chemat | 50mg | 294.80 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 5g | 3011.60 Pln | |
| Chemat | 10g | 5627.60 Pln | |
| Chemat | 5mg | 131.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide (CAS 359860-27-8) is a chemical compound with the molecular formula C18H34N4O5S and a molecular weight of 418.6 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide. InChIKey: KIJSBKNJFAUJFV-ZOBUZTSGSA-N.
| Molecular formula | C18H34N4O5S |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | KIJSBKNJFAUJFV-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)