cas: 359860-27-8 — see every product listed under this CAS number, including other names
Amine-PEG3-Biotin, 99.79% (CAS 359860-27-8) is a chemical reagent available from Chemat. Available pack sizes: 500 mg, 100 mg, 25 mg, 250 mg, 50 mg, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-111377-500 mg |
| cas | 359860-27-8 |
| size | 500 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 mg | 904.84 Pln | |
| MedChemExpress | 100 mg | 431.15 Pln | |
| MedChemExpress | 25 mg | 287.18 Pln | |
| MedChemExpress | 250 mg | 644.77 Pln | |
| MedChemExpress | 50 mg | 352.20 Pln | |
| MedChemExpress | 5 g | 3658.73 Pln | |
| MedChemExpress | 1 g | 1299.58 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.79% |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide (CAS 359860-27-8) is a chemical compound with the molecular formula C18H34N4O5S and a molecular weight of 418.6 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide. InChIKey: KIJSBKNJFAUJFV-ZOBUZTSGSA-N.
| Molecular formula | C18H34N4O5S |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | KIJSBKNJFAUJFV-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)