Biotin-PEG(3)-NH2
cas: 359860-27-8 — see every product listed under this CAS number, including other names
Biotin-PEG(3)-NH2 (CAS 359860-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | RL-4210.0100 |
| cas | 359860-27-8 |
| size | 100mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 100mg | 410.96 Pln | |
| Iris Biotech | 250mg | 611.60 Pln | |
| Iris Biotech | 500mg | 1012.88 Pln | |
| Iris Biotech | 1g | 1514.48 Pln | |
| Iris Biotech | 5g | 5126.00 Pln | |
| Iris Biotech | 25g | 20174.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | 2 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide (CAS 359860-27-8) is a chemical compound with the molecular formula C18H34N4O5S and a molecular weight of 418.6 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide. InChIKey: KIJSBKNJFAUJFV-ZOBUZTSGSA-N.
| Molecular formula | C18H34N4O5S |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | KIJSBKNJFAUJFV-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)