cas: 359860-27-8 — see every product listed under this CAS number, including other names
N-(2-(2-(2-(2-Aminoethoxy)ethoxy)ethoxy)ethyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide, 97% (CAS 359860-27-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869390-50MG |
| cas | 359860-27-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 310.33 Pln | |
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1309.97 Pln | |
| Fluorochem | 5g | 3809.09 Pln | |
| Fluorochem | 10g | 6948.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide (CAS 359860-27-8) is a chemical compound with the molecular formula C18H34N4O5S and a molecular weight of 418.6 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide. InChIKey: KIJSBKNJFAUJFV-ZOBUZTSGSA-N.
| Molecular formula | C18H34N4O5S |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | KIJSBKNJFAUJFV-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)