Products 40793-68-8

CAS 40793-68-8 appears in our catalog under these names: (+/-)-1-Methoxy-1-(trifluoromethyl)phenylacetyl chloride, 95%, 3,3,3-Trifluoro-2-methoxy-2-phenylpropanoyl chloride, 99%, (+/-)-a-Methoxy-a-trifluoromethylphenylacetyl chloride, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride (CAS 40793-68-8) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: 3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride. InChIKey: PAORVUMOXXAMPL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClF3O2
Molecular weight252.62 g/mol
IUPAC name3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride
InChIKeyPAORVUMOXXAMPL-UHFFFAOYSA-N
SMILESCOC(C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)