CAS 1214346-36-7 is the registry number for 2-Chloro-6-(trifluoromethyl)benzoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 2-chloro-6-(trifluoromethyl)benzoate (CAS 1214346-36-7) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: ethyl 2-chloro-6-(trifluoromethyl)benzoate. InChIKey: JICZPVIUDBATRW-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | ethyl 2-chloro-6-(trifluoromethyl)benzoate |
| InChIKey | JICZPVIUDBATRW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)