Products 1247852-88-5
CAS 1247852-88-5 appears in our catalog under these names: methyl 2-chloro-2-[3-(trifluoromethyl)phenyl]acetate, 95%, Methyl 2-chloro-2-(3-(trifluoromethyl)phenyl)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 2-chloro-2-[3-(trifluoromethyl)phenyl]acetate (CAS 1247852-88-5) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: methyl 2-chloro-2-[3-(trifluoromethyl)phenyl]acetate. InChIKey: SQEBQISWCVFXCQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | methyl 2-chloro-2-[3-(trifluoromethyl)phenyl]acetate |
| InChIKey | SQEBQISWCVFXCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)