Products 2912-62-1
CAS 2912-62-1 appears in our catalog under these names: 2-Chloro-2-phenylacetyl chloride, 90%, alpha-Chlorophenylacetyl Chloride, ±-Chlorophenylacetyl Chloride, 2-chloro-2-phenylacetyl chloride 90%, (+/-)-2-CHLORO-2-PHENYLACETYL CHLORIDE,. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 500mg, 25g, 10g, 100g.
2-chloro-2-phenylacetyl chloride (CAS 2912-62-1) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 2-chloro-2-phenylacetyl chloride. InChIKey: FGEAOSXMQZWHIQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 2-chloro-2-phenylacetyl chloride |
| InChIKey | FGEAOSXMQZWHIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Chloro(phenyl)acetyl chloride, alpha-Chlorophenylacetyl chloride, .alpha.-Chlorophenylacetyl chloride, .ALPHA.-CHLOROBENZENEACETYL CHLORIDE, .ALPHA.-CHLORO-.ALPHA.-PHENYLACETYL CHLORIDE, Alpha-chlorobenzeneacetyl chloride, PHENYL(CHLORO)ACETYL CHLORIDE, (+-)-, ALPHA-CHLORO-ALPHA-PHENYLACETYL CHLORIDE, 2-chloro-2-phenylacetyl chloride, Benzeneacetyl chloride, alpha-chloro-