cas: 1011-74-1 — see every product listed under this CAS number, including other names
(±)-Normetanephrine hydrochloride, 95%+, 95%+ (CAS 1011-74-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114RF-5mg |
| cas | 1011-74-1 |
| size | 5mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 352.40 Pln | |
| Chemat | 10mg | 530.00 Pln | |
| Chemat | 25mg | 818.00 Pln | |
| Chemat | 50mg | 1144.40 Pln | |
| Chemat | 100mg | 1811.60 Pln | |
| Chemat | 250mg | 3563.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-(2-amino-1-hydroxyethyl)-2-methoxyphenol;hydrochloride (CAS 1011-74-1) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: 4-(2-amino-1-hydroxyethyl)-2-methoxyphenol;hydrochloride. InChIKey: VKFPRGQZWKTEON-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-(2-amino-1-hydroxyethyl)-2-methoxyphenol;hydrochloride |
| InChIKey | VKFPRGQZWKTEON-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(CN)O)O.Cl |
Computed by PubChem (NCBI)