Products 80141-53-3

CAS 80141-53-3 is the registry number for Captopril Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 80141-53-3) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: (2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: NIMJOZVSLAEJSX-RQJHMYQMSA-N.

Identity
Molecular formulaC9H14ClNO3
Molecular weight219.66 g/mol
IUPAC name(2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid
InChIKeyNIMJOZVSLAEJSX-RQJHMYQMSA-N
SMILESC[C@H](CCl)C(=O)N1CCC[C@H]1C(=O)O

Computed by PubChem (NCBI)