CAS 80141-53-3 is the registry number for Captopril Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 80141-53-3) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: (2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: NIMJOZVSLAEJSX-RQJHMYQMSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-chloro-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | NIMJOZVSLAEJSX-RQJHMYQMSA-N |
| SMILES | C[C@H](CCl)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)