Products 1246616-68-1
CAS 1246616-68-1 is the registry number for 4-Chloro-2-dimethylaminomethylene-3-oxo-butyric acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
Ethyl (2Z)-4-chloro-2-(dimethylaminomethylidene)-3-oxobutanoate (CAS 1246616-68-1) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: ethyl (2Z)-4-chloro-2-(dimethylaminomethylidene)-3-oxobutanoate. InChIKey: DMPAUMVQAGFPRL-SREVYHEPSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | ethyl (2Z)-4-chloro-2-(dimethylaminomethylidene)-3-oxobutanoate |
| InChIKey | DMPAUMVQAGFPRL-SREVYHEPSA-N |
| SMILES | CCOC(=O)/C(=C\N(C)C)/C(=O)CCl |
Computed by PubChem (NCBI)