CAS 55-31-2 appears in our catalog under these names: L-Epinephrine hydrochloride, 95%, Epinephrine HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 200mg, 10mM (in 1ml dmso), 50mg.
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride (CAS 55-31-2) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride. InChIKey: ATADHKWKHYVBTJ-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrochloride |
| InChIKey | ATADHKWKHYVBTJ-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)O.Cl |
Computed by PubChem (NCBI)