cas: 368866-34-6 — see every product listed under this CAS number, including other names
(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]tetrahydro-2H-pyran-4-propanoic acid, 97%, 97% (CAS 368866-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BK4K-100mg |
| cas | 368866-34-6 |
| size | 100mg |
| availability | 27.9g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 500mg | 510.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Chemat | 25g | 4470.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(oxan-4-yl)propanoic acid (CAS 368866-34-6) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(oxan-4-yl)propanoic acid. InChIKey: GHWBOWNFASFNHK-NRFANRHFSA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(oxan-4-yl)propanoic acid |
| InChIKey | GHWBOWNFASFNHK-NRFANRHFSA-N |
| SMILES | C1COCCC1C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)