CAS 2865160-81-0 is the registry number for Fmoc-(4R)-4-propoxy-L-proline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-propoxypyrrolidine-2-carboxylic acid (CAS 2865160-81-0) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-propoxypyrrolidine-2-carboxylic acid. InChIKey: KRZFJUSROLMRFV-VFNWGFHPSA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-propoxypyrrolidine-2-carboxylic acid |
| InChIKey | KRZFJUSROLMRFV-VFNWGFHPSA-N |
| SMILES | CCCO[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)