Products 147365-12-6
CAS 147365-12-6 appears in our catalog under these names: Doxepin EP Impurity D, (Z)-3-(Dibenzo(b,e)oxepin-11(6H)-ylidene)-N,N-dimethylpropan-1-amine Maleate. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 50mg.
(3Z)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N,N-dimethylpropan-1-amine;(Z)-but-2-enedioic acid (CAS 147365-12-6) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: (3Z)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N,N-dimethylpropan-1-amine;(Z)-but-2-enedioic acid. InChIKey: DJGDNODXKWECBD-QXGSISKLSA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (3Z)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N,N-dimethylpropan-1-amine;(Z)-but-2-enedioic acid |
| InChIKey | DJGDNODXKWECBD-QXGSISKLSA-N |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2COC3=CC=CC=C31.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)