Products 2757835-89-3
CAS 2757835-89-3 is the registry number for (2R,3R)-1-Fmoc-3-tert-butoxy azetidine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]azetidine-2-carboxylic acid (CAS 2757835-89-3) is a chemical compound with the molecular formula C23H25NO5 and a molecular weight of 395.4 g/mol. IUPAC name: (2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]azetidine-2-carboxylic acid. InChIKey: JLUWWYWQDDZFKA-WOJBJXKFSA-N.
| Molecular formula | C23H25NO5 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | (2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]azetidine-2-carboxylic acid |
| InChIKey | JLUWWYWQDDZFKA-WOJBJXKFSA-N |
| SMILES | CC(C)(C)O[C@@H]1CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)