cas: 17401-06-8 — see every product listed under this CAS number, including other names
(-)-1,4-Di-O-benzyl-L-threitol, >98.0%(GC) (CAS 17401-06-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2240-1G |
| cas | 17401-06-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 546.15 Pln | |
| TCI | 5g | 1706.62 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
(2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol (CAS 17401-06-8) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol. InChIKey: YAVAVQDYJARRAU-ROUUACIJSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol |
| InChIKey | YAVAVQDYJARRAU-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]([C@H](COCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)