cas: 17401-06-8 — see every product listed under this CAS number, including other names
(2S,3S)-1,4-Bis(benzyloxy)butane-2,3-diol (CAS 17401-06-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZDS-250mg |
| cas | 17401-06-8 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 2123.60 Pln |
| delivery time | 3 weeks |
|---|
(2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol (CAS 17401-06-8) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol. InChIKey: YAVAVQDYJARRAU-ROUUACIJSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol |
| InChIKey | YAVAVQDYJARRAU-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]([C@H](COCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)