cas: 122292-85-7 — see every product listed under this CAS number, including other names
(-)-Trichostatin A, >98.0%(HPLC) (CAS 122292-85-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3633-10MG |
| cas | 122292-85-7 |
| size | 10mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10mg | 1352.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
(2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide (CAS 122292-85-7) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: (2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide. InChIKey: RTKIYFITIVXBLE-LEJRBOCMSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | (2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| InChIKey | RTKIYFITIVXBLE-LEJRBOCMSA-N |
| SMILES | C[C@@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)