Products 1251000-17-5
CAS 1251000-17-5 appears in our catalog under these names: 5-Oxo-8-phenyl-2,6-diaza-spiro[3.4]octane-2-carboxylic acid tert-butyl ester, 95%, tert-Butyl 5-oxo-8-phenyl-2,6-diazaspiro(3.4)octane-2-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 100mg, 1g, 250mg.
Tert-butyl 5-oxo-8-phenyl-2,6-diazaspiro[3.4]octane-2-carboxylate (CAS 1251000-17-5) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: tert-butyl 5-oxo-8-phenyl-2,6-diazaspiro[3.4]octane-2-carboxylate. InChIKey: SXQCENPMBNBTBU-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | tert-butyl 5-oxo-8-phenyl-2,6-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | SXQCENPMBNBTBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CNC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)