CAS 1035841-19-0 is the registry number for 1-(5-tert-Butyl-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CAS 1035841-19-0) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: 1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid. InChIKey: BFYORZUNZNWESZ-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | 1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
| InChIKey | BFYORZUNZNWESZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)N3CCC(CC3)C(=O)O |
Computed by PubChem (NCBI)