Products 122292-85-7
CAS 122292-85-7 appears in our catalog under these names: (-)-Trichostatin a, 95%, (–)–Trichostatin A, Trichostatin A S-isomer, (-)-Trichostatin A, (-)-Trichostatin A, >98.0%(HPLC). Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg, 10 mg, 5 mg.
(2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide (CAS 122292-85-7) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: (2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide. InChIKey: RTKIYFITIVXBLE-LEJRBOCMSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | (2E,4E,6S)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| InChIKey | RTKIYFITIVXBLE-LEJRBOCMSA-N |
| SMILES | C[C@@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)