cas: 737790-46-4 — see every product listed under this CAS number, including other names
(1-(((TERT-BUTYLDIMETHYLSILYL)OXY)METHYL)CYCLOPROPYL)METHANOL, 97% (CAS 737790-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F528104-100MG |
| cas | 737790-46-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 2.5g | 1934.75 Pln | |
| Fluorochem | 5g | 2455.40 Pln | |
| Fluorochem | 25g | 11941.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol (CAS 737790-46-4) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol. InChIKey: RYQZYGDRTDFDEF-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanol |
| InChIKey | RYQZYGDRTDFDEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CC1)CO |
Computed by PubChem (NCBI)